|
Medical Definition of Lactobacillic acid
1. CH3(CH2)4CH2-CH-CH-(CH2)9COOH; (1R-cis)-2-hexycyclopropanedecanoic acid;a major constituent of the lipids of lactobacilli; notable for the presence of a cyclopropane ring in the molecule. (05 Mar 2000)
|
1. CH3(CH2)4CH2-CH-CH-(CH2)9COOH; (1R-cis)-2-hexycyclopropanedecanoic acid;a major constituent of the lipids of lactobacilli; notable for the presence of a cyclopropane ring in the molecule. (05 Mar 2000)